C33H47BClNO3 — CID 159530966
N-[1-(4-chlorophenyl)-3-[2,2,3-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-3-yl]cyclobutyl]benzamide (PubChem CID 159530966) has the molecular formula C33H47BClNO3 and a molecular weight of 552.01 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-[2,2,3-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-3-yl]cyclobutyl]benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-[2,2,3-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-3-yl]cyclobutyl]benzamide |
|---|---|
| PubChem CID | 159530966 |
| Molecular Formula | C33H47BClNO3 |
| Molecular Weight | 552.01 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-[2,2,3-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-3-yl]cyclobutyl]benzamide |
| SMILES | CC(C)(C)C(C)(CCCCB1OC(C)(C)C(C)(C)O1)C1CC(NC(=O)c2ccccc2)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C33H47BClNO3/c1-29(2,3)32(8,20-12-13-21-34-38-30(4,5)31(6,7)39-34)26-22-33(23-26,25-16-18-27(35)19-17-25)36-28(37)24-14-10-9-11-15-24/h9-11,14-19,26H,12-13,20-23H2,1-8H3,(H,36,37) |
| InChIKey | PQQSENCEIOILKI-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.01 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|