C32H52BN3O4 — CID 162700296
2-acetamido-N-tert-butyl-2-[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide (PubChem CID 162700296) has the molecular formula C32H52BN3O4 and a molecular weight of 553.60 g/mol. Its IUPAC name is 2-acetamido-N-tert-butyl-2-[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide.
| Compound Name | 2-acetamido-N-tert-butyl-2-[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide |
|---|---|
| PubChem CID | 162700296 |
| Molecular Formula | C32H52BN3O4 |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.41 |
| IUPAC Name | 2-acetamido-N-tert-butyl-2-[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide |
| SMILES | CC(=O)NC(CCCCB1OC(C)(C)C(C)(C)O1)(C(=O)NC(C)(C)C)C1CCN(C2Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C32H52BN3O4/c1-23(37)34-32(28(38)35-29(2,3)4,17-11-12-18-33-39-30(5,6)31(7,8)40-33)26-15-19-36(20-16-26)27-21-24-13-9-10-14-25(24)22-27/h9-10,13-14,26-27H,11-12,15-22H2,1-8H3,(H,34,37)(H,35,38) |
| InChIKey | KGULPAJEUCWBRX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|