C28H46BN3O3S — CID 140906509
(R)-N-[(1R)-1-(1-benzylpiperidin-4-yl)-1-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-2-methylpropane-2-sulfinamide (PubChem CID 140906509) has the molecular formula C28H46BN3O3S and a molecular weight of 515.57 g/mol. Its IUPAC name is (R)-N-[(1R)-1-(1-benzylpiperidin-4-yl)-1-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-(1-benzylpiperidin-4-yl)-1-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140906509 |
| Molecular Formula | C28H46BN3O3S |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | (R)-N-[(1R)-1-(1-benzylpiperidin-4-yl)-1-isocyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-2-methylpropane-2-sulfinamide |
| SMILES | [C-]#[N+][C@](CCCCB1OC(C)(C)C(C)(C)O1)(N[S@](=O)C(C)(C)C)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H46BN3O3S/c1-25(2,3)36(33)31-28(30-8,18-12-13-19-29-34-26(4,5)27(6,7)35-29)24-16-20-32(21-17-24)22-23-14-10-9-11-15-23/h9-11,14-15,24,31H,12-13,16-22H2,1-7H3/t28-,36-/m1/s1 |
| InChIKey | CBEUFKAOKJBJSI-XVODIUIHSA-N |
| XLogP | 5.83 |
| TPSA | 55.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|