C16H23BClNO3 — CID 122374176
N-[1-(4-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]acetamide (PubChem CID 122374176) has the molecular formula C16H23BClNO3 and a molecular weight of 323.63 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 122374176 |
| Molecular Formula | C16H23BClNO3 |
| Molecular Weight | 323.63 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[1-(4-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NC(C)(B1OC(C)(C)C(C)(C)O1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23BClNO3/c1-11(20)19-16(6,12-7-9-13(18)10-8-12)17-21-14(2,3)15(4,5)22-17/h7-10H,1-6H3,(H,19,20) |
| InChIKey | RHXRHOIGELVUTA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|