C19H30BNO6 — CID 122374165
N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(3,4,5-trimethoxyphenyl)ethyl]acetamide (PubChem CID 122374165) has the molecular formula C19H30BNO6 and a molecular weight of 379.26 g/mol. Its IUPAC name is N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(3,4,5-trimethoxyphenyl)ethyl]acetamide.
| Compound Name | N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(3,4,5-trimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 122374165 |
| Molecular Formula | C19H30BNO6 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | N-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(3,4,5-trimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(C(C)(NC(C)=O)B2OC(C)(C)C(C)(C)O2)cc(OC)c1OC |
| InChI | InChI=1S/C19H30BNO6/c1-12(22)21-19(6,20-26-17(2,3)18(4,5)27-20)13-10-14(23-7)16(25-9)15(11-13)24-8/h10-11H,1-9H3,(H,21,22) |
| InChIKey | RNGCPWQCCQLFCS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|