C19H28BClO5 — CID 132547529
tert-butyl (2R)-2-(4-chlorophenyl)-2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 132547529) has the molecular formula C19H28BClO5 and a molecular weight of 382.69 g/mol. Its IUPAC name is tert-butyl (2R)-2-(4-chlorophenyl)-2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | tert-butyl (2R)-2-(4-chlorophenyl)-2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 132547529 |
| Molecular Formula | C19H28BClO5 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | tert-butyl (2R)-2-(4-chlorophenyl)-2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@](O)(CB1OC(C)(C)C(C)(C)O1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H28BClO5/c1-16(2,3)24-15(22)19(23,13-8-10-14(21)11-9-13)12-20-25-17(4,5)18(6,7)26-20/h8-11,23H,12H2,1-7H3/t19-/m1/s1 |
| InChIKey | AVLLYJHLCXGOAG-LJQANCHMSA-N |
| XLogP | 3.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|