5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate

C17H23ClO4 — CID 67338177

IUPAC5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate
SMILESCOC(=O)C(C)(CCC(=O)OC(C)(C)C)c1ccc(Cl)cc1
InChIInChI=1S/C17H23ClO4/c1-16(2,3)22-14(19)10-11-17(4,15(20)21-5)12-6-8-13(18)9-7-12/h6-9H,10-11H2,1-5H3
InChIKeyDSCMDJCVRRIQQL-UHFFFAOYSA-N
MW326.82 g/mol
LogP3.89
Rot. Bonds5

About 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate

5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate (PubChem CID 67338177) has the molecular formula C17H23ClO4 and a molecular weight of 326.82 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate.

Molecular Properties

Compound Name5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate
PubChem CID67338177
Molecular FormulaC17H23ClO4
Molecular Weight326.82 g/mol
Exact Mass326.13
IUPAC Name5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate
SMILESCOC(=O)C(C)(CCC(=O)OC(C)(C)C)c1ccc(Cl)cc1
InChIInChI=1S/C17H23ClO4/c1-16(2,3)22-14(19)10-11-17(4,15(20)21-5)12-6-8-13(18)9-7-12/h6-9H,10-11H2,1-5H3
InChIKeyDSCMDJCVRRIQQL-UHFFFAOYSA-N
XLogP3.89
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.82
LogP ≤ 53.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
The IUPAC name of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate (CID 67338177) is 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate.
What is the SMILES notation for 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
The canonical SMILES for 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate is COC(=O)C(C)(CCC(=O)OC(C)(C)C)c1ccc(Cl)cc1.
What is the InChIKey of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
The InChIKey is DSCMDJCVRRIQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClO4/c1-16(2,3)22-14(19)10-11-17(4,15(20)21-5)12-6-8-13(18)9-7-12/h6-9H,10-11H2,1-5H3.
What are the key properties of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate has a molecular weight of 326.82 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate is sourced from PubChem (CID 67338177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).