About 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate
5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate (PubChem CID 67338177) has the molecular formula C17H23ClO4
and a molecular weight of 326.82 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate.
Molecular Properties
| Compound Name | 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate |
| PubChem CID | 67338177 |
| Molecular Formula | C17H23ClO4 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate |
| SMILES | COC(=O)C(C)(CCC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClO4/c1-16(2,3)22-14(19)10-11-17(4,15(20)21-5)12-6-8-13(18)9-7-12/h6-9H,10-11H2,1-5H3 |
| InChIKey | DSCMDJCVRRIQQL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
The IUPAC name of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate (CID 67338177) is 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate.
What is the SMILES notation for 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
The canonical SMILES for 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate is COC(=O)C(C)(CCC(=O)OC(C)(C)C)c1ccc(Cl)cc1.
What is the InChIKey of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
The InChIKey is DSCMDJCVRRIQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClO4/c1-16(2,3)22-14(19)10-11-17(4,15(20)21-5)12-6-8-13(18)9-7-12/h6-9H,10-11H2,1-5H3.
What are the key properties of 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate?
5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate has a molecular weight of 326.82 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)-2-methylpentanedioate is sourced from PubChem (CID 67338177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).