C29H42O6 — CID 54207911
tert-butyl 4,4-bis[4-(2-methoxypropan-2-yloxy)phenyl]pentanoate (PubChem CID 54207911) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is tert-butyl 4,4-bis[4-(2-methoxypropan-2-yloxy)phenyl]pentanoate.
| Compound Name | tert-butyl 4,4-bis[4-(2-methoxypropan-2-yloxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 54207911 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | tert-butyl 4,4-bis[4-(2-methoxypropan-2-yloxy)phenyl]pentanoate |
| SMILES | COC(C)(C)Oc1ccc(C(C)(CCC(=O)OC(C)(C)C)c2ccc(OC(C)(C)OC)cc2)cc1 |
| InChI | InChI=1S/C29H42O6/c1-26(2,3)35-25(30)19-20-29(8,21-11-15-23(16-12-21)33-27(4,5)31-9)22-13-17-24(18-14-22)34-28(6,7)32-10/h11-18H,19-20H2,1-10H3 |
| InChIKey | PTVMDCCXQGQKMF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|