C33H50O6 — CID 15375049
tert-butyl 4,4-bis[4-(1-butoxyethoxy)phenyl]pentanoate (PubChem CID 15375049) has the molecular formula C33H50O6 and a molecular weight of 542.76 g/mol. Its IUPAC name is tert-butyl 4,4-bis[4-(1-butoxyethoxy)phenyl]pentanoate.
| Compound Name | tert-butyl 4,4-bis[4-(1-butoxyethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 15375049 |
| Molecular Formula | C33H50O6 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | tert-butyl 4,4-bis[4-(1-butoxyethoxy)phenyl]pentanoate |
| SMILES | CCCCOC(C)Oc1ccc(C(C)(CCC(=O)OC(C)(C)C)c2ccc(OC(C)OCCCC)cc2)cc1 |
| InChI | InChI=1S/C33H50O6/c1-9-11-23-35-25(3)37-29-17-13-27(14-18-29)33(8,22-21-31(34)39-32(5,6)7)28-15-19-30(20-16-28)38-26(4)36-24-12-10-2/h13-20,25-26H,9-12,21-24H2,1-8H3 |
| InChIKey | SZPXFRKVKIKZSP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|