C29H38O6 — CID 18680587
tert-butyl 4,4-bis[4-(oxolan-2-yloxy)phenyl]pentanoate (PubChem CID 18680587) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is tert-butyl 4,4-bis[4-(oxolan-2-yloxy)phenyl]pentanoate.
| Compound Name | tert-butyl 4,4-bis[4-(oxolan-2-yloxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 18680587 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | tert-butyl 4,4-bis[4-(oxolan-2-yloxy)phenyl]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCC(C)(c1ccc(OC2CCCO2)cc1)c1ccc(OC2CCCO2)cc1 |
| InChI | InChI=1S/C29H38O6/c1-28(2,3)35-25(30)17-18-29(4,21-9-13-23(14-10-21)33-26-7-5-19-31-26)22-11-15-24(16-12-22)34-27-8-6-20-32-27/h9-16,26-27H,5-8,17-20H2,1-4H3 |
| InChIKey | QIUNFGSPNLWXBA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |