C27H38O8 — CID 15375051
tert-butyl 4,4-bis[4-(dimethoxymethoxy)phenyl]pentanoate (PubChem CID 15375051) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is tert-butyl 4,4-bis[4-(dimethoxymethoxy)phenyl]pentanoate.
| Compound Name | tert-butyl 4,4-bis[4-(dimethoxymethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 15375051 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | tert-butyl 4,4-bis[4-(dimethoxymethoxy)phenyl]pentanoate |
| SMILES | COC(OC)Oc1ccc(C(C)(CCC(=O)OC(C)(C)C)c2ccc(OC(OC)OC)cc2)cc1 |
| InChI | InChI=1S/C27H38O8/c1-26(2,3)35-23(28)17-18-27(4,19-9-13-21(14-10-19)33-24(29-5)30-6)20-11-15-22(16-12-20)34-25(31-7)32-8/h9-16,24-25H,17-18H2,1-8H3 |
| InChIKey | REJFFOVPCKZHCD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|