C27H34O8 — CID 70654079
4,4-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]pentanoic acid (PubChem CID 70654079) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is 4,4-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]pentanoic acid.
| Compound Name | 4,4-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 70654079 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 4,4-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(C(C)(CCC(=O)O)c2ccc(OC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H34O8/c1-25(2,3)34-23(30)32-20-12-8-18(9-13-20)27(7,17-16-22(28)29)19-10-14-21(15-11-19)33-24(31)35-26(4,5)6/h8-15H,16-17H2,1-7H3,(H,28,29) |
| InChIKey | UFLAUQWFMCIXSV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|