C36H44O9 — CID 90367445
2-[1-[4-[2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]ethoxy]ethyl 6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]naphthalene-2-carboxylate (PubChem CID 90367445) has the molecular formula C36H44O9 and a molecular weight of 620.74 g/mol. Its IUPAC name is 2-[1-[4-[2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]ethoxy]ethyl 6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]naphthalene-2-carboxylate.
| Compound Name | 2-[1-[4-[2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]ethoxy]ethyl 6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90367445 |
| Molecular Formula | C36H44O9 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 2-[1-[4-[2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]ethoxy]ethyl 6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]naphthalene-2-carboxylate |
| SMILES | C=C(C)C(=O)OC(C)(CCC)c1ccc(OC(C)OCCOC(=O)c2ccc3cc(OCC(=O)OC(C)(C)C)ccc3c2)cc1 |
| InChI | InChI=1S/C36H44O9/c1-9-18-36(8,45-33(38)24(2)3)29-13-16-30(17-14-29)43-25(4)40-19-20-41-34(39)28-11-10-27-22-31(15-12-26(27)21-28)42-23-32(37)44-35(5,6)7/h10-17,21-22,25H,2,9,18-20,23H2,1,3-8H3 |
| InChIKey | OUBDMXOOTQBHFH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|