C33H37Cl3O9 — CID 157385921
bis[2-(4-chlorophenyl)propan-2-yl] propanedioate;2-(4-chlorophenyl)propan-2-ol;propanedioic acid (PubChem CID 157385921) has the molecular formula C33H37Cl3O9 and a molecular weight of 684.01 g/mol. Its IUPAC name is bis[2-(4-chlorophenyl)propan-2-yl] propanedioate;2-(4-chlorophenyl)propan-2-ol;propanedioic acid.
| Compound Name | bis[2-(4-chlorophenyl)propan-2-yl] propanedioate;2-(4-chlorophenyl)propan-2-ol;propanedioic acid |
|---|---|
| PubChem CID | 157385921 |
| Molecular Formula | C33H37Cl3O9 |
| Molecular Weight | 684.01 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | bis[2-(4-chlorophenyl)propan-2-yl] propanedioate;2-(4-chlorophenyl)propan-2-ol;propanedioic acid |
| SMILES | CC(C)(O)c1ccc(Cl)cc1.CC(C)(OC(=O)CC(=O)OC(C)(C)c1ccc(Cl)cc1)c1ccc(Cl)cc1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C21H22Cl2O4.C9H11ClO.C3H4O4/c1-20(2,14-5-9-16(22)10-6-14)26-18(24)13-19(25)27-21(3,4)15-7-11-17(23)12-8-15;1-9(2,11)7-3-5-8(10)6-4-7;4-2(5)1-3(6)7/h5-12H,13H2,1-4H3;3-6,11H,1-2H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | BLKSLRAHLHHBQC-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.01 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|