C25H25N3O3 — CID 11294394
2-ethyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]butanoic acid (PubChem CID 11294394) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-ethyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]butanoic acid.
| Compound Name | 2-ethyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]butanoic acid |
|---|---|
| PubChem CID | 11294394 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-ethyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]butanoic acid |
| SMILES | CCC(CC)(/N=C(\c1ccccc1)c1ccccc1NC(=O)c1ccccn1)C(=O)O |
| InChI | InChI=1S/C25H25N3O3/c1-3-25(4-2,24(30)31)28-22(18-12-6-5-7-13-18)19-14-8-9-15-20(19)27-23(29)21-16-10-11-17-26-21/h5-17H,3-4H2,1-2H3,(H,27,29)(H,30,31)/b28-22+ |
| InChIKey | VMOIRGOUTNBAJP-XAYXJRQQSA-N |
| XLogP | 4.81 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|