C35H29N3O3 — CID 101227294
2-benzyl-3-phenyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]propanoic acid (PubChem CID 101227294) has the molecular formula C35H29N3O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-benzyl-3-phenyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]propanoic acid.
| Compound Name | 2-benzyl-3-phenyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 101227294 |
| Molecular Formula | C35H29N3O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-benzyl-3-phenyl-2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]propanoic acid |
| SMILES | O=C(Nc1ccccc1/C(=N/C(Cc1ccccc1)(Cc1ccccc1)C(=O)O)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C35H29N3O3/c39-33(31-22-12-13-23-36-31)37-30-21-11-10-20-29(30)32(28-18-8-3-9-19-28)38-35(34(40)41,24-26-14-4-1-5-15-26)25-27-16-6-2-7-17-27/h1-23H,24-25H2,(H,37,39)(H,40,41)/b38-32+ |
| InChIKey | BOFXBOYKSGQOHK-WAQNPYFYSA-N |
| XLogP | 6.48 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|