C24H19N3O3 — CID 10983297
2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]pent-4-ynoic acid (PubChem CID 10983297) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]pent-4-ynoic acid.
| Compound Name | 2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 10983297 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]pent-4-ynoic acid |
| SMILES | C#CCC(/N=C(\c1ccccc1)c1ccccc1NC(=O)c1ccccn1)C(=O)O |
| InChI | InChI=1S/C24H19N3O3/c1-2-10-21(24(29)30)26-22(17-11-4-3-5-12-17)18-13-6-7-14-19(18)27-23(28)20-15-8-9-16-25-20/h1,3-9,11-16,21H,10H2,(H,27,28)(H,29,30)/b26-22+ |
| InChIKey | VAMRCFWPBALNMT-XTCLZLMSSA-N |
| XLogP | 3.65 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|