C35H25F2N3O3 — CID 53475255
(Z)-2-[bis(4-fluorophenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid (PubChem CID 53475255) has the molecular formula C35H25F2N3O3 and a molecular weight of 573.60 g/mol. Its IUPAC name is (Z)-2-[bis(4-fluorophenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid.
| Compound Name | (Z)-2-[bis(4-fluorophenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 53475255 |
| Molecular Formula | C35H25F2N3O3 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | (Z)-2-[bis(4-fluorophenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\N=C(/c1ccccc1)c1ccccc1NC(=O)c1ccccn1)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C35H25F2N3O3/c36-26-17-13-23(14-18-26)32(24-15-19-27(37)20-16-24)29(35(42)43)22-39-33(25-8-2-1-3-9-25)28-10-4-5-11-30(28)40-34(41)31-12-6-7-21-38-31/h1-22,32H,(H,40,41)(H,42,43)/b29-22-,39-33+ |
| InChIKey | XNQREUXCTISEHS-VDGREMDSSA-N |
| XLogP | 7.25 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|