C35H23F2N3NiO3 — CID 53475254
(Z)-2-[bis(4-fluorophenyl)methyl]-3-[[[2-[[oxido(pyridin-2-yl)methylidene]amino]phenyl]-phenylmethylidene]amino]prop-2-enoate;nickel(2+) (PubChem CID 53475254) has the molecular formula C35H23F2N3NiO3 and a molecular weight of 630.28 g/mol. Its IUPAC name is (Z)-2-[bis(4-fluorophenyl)methyl]-3-[[[2-[[oxido(pyridin-2-yl)methylidene]amino]phenyl]-phenylmethylidene]amino]prop-2-enoate;nickel(2+).
| Compound Name | (Z)-2-[bis(4-fluorophenyl)methyl]-3-[[[2-[[oxido(pyridin-2-yl)methylidene]amino]phenyl]-phenylmethylidene]amino]prop-2-enoate;nickel(2+) |
|---|---|
| PubChem CID | 53475254 |
| Molecular Formula | C35H23F2N3NiO3 |
| Molecular Weight | 630.28 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | (Z)-2-[bis(4-fluorophenyl)methyl]-3-[[[2-[[oxido(pyridin-2-yl)methylidene]amino]phenyl]-phenylmethylidene]amino]prop-2-enoate;nickel(2+) |
| SMILES | O=C([O-])/C(=C\N=C(/c1ccccc1)c1ccccc1/N=C(\[O-])c1ccccn1)C(c1ccc(F)cc1)c1ccc(F)cc1.[Ni+2] |
| InChI | InChI=1S/C35H25F2N3O3.Ni/c36-26-17-13-23(14-18-26)32(24-15-19-27(37)20-16-24)29(35(42)43)22-39-33(25-8-2-1-3-9-25)28-10-4-5-11-30(28)40-34(41)31-12-6-7-21-38-31;/h1-22,32H,(H,40,41)(H,42,43);/q;+2/p-2/b29-22-,39-33+; |
| InChIKey | BGJFZMDOMYXKCK-QWYUJRTJSA-L |
| XLogP | 5.10 |
| TPSA | 100.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|