C30H25N3O3 — CID 53475166
(Z)-2-[(4-methylphenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid (PubChem CID 53475166) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is (Z)-2-[(4-methylphenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid.
| Compound Name | (Z)-2-[(4-methylphenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 53475166 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (Z)-2-[(4-methylphenyl)methyl]-3-[[phenyl-[2-(pyridine-2-carbonylamino)phenyl]methylidene]amino]prop-2-enoic acid |
| SMILES | Cc1ccc(C/C(=C/N=C(\c2ccccc2)c2ccccc2NC(=O)c2ccccn2)C(=O)O)cc1 |
| InChI | InChI=1S/C30H25N3O3/c1-21-14-16-22(17-15-21)19-24(30(35)36)20-32-28(23-9-3-2-4-10-23)25-11-5-6-12-26(25)33-29(34)27-13-7-8-18-31-27/h2-18,20H,19H2,1H3,(H,33,34)(H,35,36)/b24-20-,32-28+ |
| InChIKey | OEMHFRPDZBCKGG-VCNIZDLLSA-N |
| XLogP | 5.69 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|