C11H16N2O2 — CID 115093984
1-[5-(piperidin-4-ylmethyl)-1,2-oxazol-3-yl]ethanone (PubChem CID 115093984) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-[5-(piperidin-4-ylmethyl)-1,2-oxazol-3-yl]ethanone.
| Compound Name | 1-[5-(piperidin-4-ylmethyl)-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 115093984 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-[5-(piperidin-4-ylmethyl)-1,2-oxazol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(CC2CCNCC2)on1 |
| InChI | InChI=1S/C11H16N2O2/c1-8(14)11-7-10(15-13-11)6-9-2-4-12-5-3-9/h7,9,12H,2-6H2,1H3 |
| InChIKey | RRUPWLPJYKPEOH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |