C16H19FN4O2 — CID 166270185
N-(2-amino-5-fluorophenyl)-5-(piperidin-4-ylmethyl)-1,2-oxazole-3-carboxamide (PubChem CID 166270185) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-5-(piperidin-4-ylmethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-5-(piperidin-4-ylmethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 166270185 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-5-(piperidin-4-ylmethyl)-1,2-oxazole-3-carboxamide |
| SMILES | Nc1ccc(F)cc1NC(=O)c1cc(CC2CCNCC2)on1 |
| InChI | InChI=1S/C16H19FN4O2/c17-11-1-2-13(18)14(8-11)20-16(22)15-9-12(23-21-15)7-10-3-5-19-6-4-10/h1-2,8-10,19H,3-7,18H2,(H,20,22) |
| InChIKey | RCHGSUBAOJYLJQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|