C11H14ClF2NO3 — CID 171239923
ethyl (3R)-3-amino-2,2-difluoro-3-(2-hydroxyphenyl)propanoate;hydrochloride (PubChem CID 171239923) has the molecular formula C11H14ClF2NO3 and a molecular weight of 281.69 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2,2-difluoro-3-(2-hydroxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2,2-difluoro-3-(2-hydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171239923 |
| Molecular Formula | C11H14ClF2NO3 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | ethyl (3R)-3-amino-2,2-difluoro-3-(2-hydroxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1ccccc1O.Cl |
| InChI | InChI=1S/C11H13F2NO3.ClH/c1-2-17-10(16)11(12,13)9(14)7-5-3-4-6-8(7)15;/h3-6,9,15H,2,14H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | GJOJLLYKRFCAMA-SBSPUUFOSA-N |
| XLogP | 2.01 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|