C8H9Cl3F2N2 — CID 171312995
(1S)-1-(2,6-dichloro-3-pyridinyl)-3,3-difluoropropan-1-amine;hydrochloride (PubChem CID 171312995) has the molecular formula C8H9Cl3F2N2 and a molecular weight of 277.53 g/mol. Its IUPAC name is (1S)-1-(2,6-dichloro-3-pyridinyl)-3,3-difluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,6-dichloro-3-pyridinyl)-3,3-difluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312995 |
| Molecular Formula | C8H9Cl3F2N2 |
| Molecular Weight | 277.53 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | (1S)-1-(2,6-dichloro-3-pyridinyl)-3,3-difluoropropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CC(F)F)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C8H8Cl2F2N2.ClH/c9-6-2-1-4(8(10)14-6)5(13)3-7(11)12;/h1-2,5,7H,3,13H2;1H/t5-;/m0./s1 |
| InChIKey | BAIJVTHTJXFZGX-JEDNCBNOSA-N |
| XLogP | 3.47 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|