C10H12Cl2N2O2 — CID 178141792
ethyl 2-[(2,6-dichloro-3-pyridinyl)methylamino]acetate (PubChem CID 178141792) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is ethyl 2-[(2,6-dichloro-3-pyridinyl)methylamino]acetate.
| Compound Name | ethyl 2-[(2,6-dichloro-3-pyridinyl)methylamino]acetate |
|---|---|
| PubChem CID | 178141792 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | ethyl 2-[(2,6-dichloro-3-pyridinyl)methylamino]acetate |
| SMILES | CCOC(=O)CNCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2/c1-2-16-9(15)6-13-5-7-3-4-8(11)14-10(7)12/h3-4,13H,2,5-6H2,1H3 |
| InChIKey | QABZTDCKJGVNHL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|