C17H25Cl2FN2 — CID 171163168
1-[(1S)-1-(2-chloro-6-fluorophenyl)hept-6-enyl]piperazine;hydrochloride (PubChem CID 171163168) has the molecular formula C17H25Cl2FN2 and a molecular weight of 347.31 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-6-fluorophenyl)hept-6-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-6-fluorophenyl)hept-6-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171163168 |
| Molecular Formula | C17H25Cl2FN2 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-6-fluorophenyl)hept-6-enyl]piperazine;hydrochloride |
| SMILES | C=CCCCC[C@@H](c1c(F)cccc1Cl)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H24ClFN2.ClH/c1-2-3-4-5-9-16(21-12-10-20-11-13-21)17-14(18)7-6-8-15(17)19;/h2,6-8,16,20H,1,3-5,9-13H2;1H/t16-;/m0./s1 |
| InChIKey | ZCNJGTCKNIMMRR-NTISSMGPSA-N |
| XLogP | 4.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|