C13H22Cl3N3 — CID 171285648
1-[(1R)-1-(3-chloro-4-pyridinyl)butyl]piperazine;dihydrochloride (PubChem CID 171285648) has the molecular formula C13H22Cl3N3 and a molecular weight of 326.70 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chloro-4-pyridinyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-chloro-4-pyridinyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171285648 |
| Molecular Formula | C13H22Cl3N3 |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-[(1R)-1-(3-chloro-4-pyridinyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1ccncc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H20ClN3.2ClH/c1-2-3-13(17-8-6-15-7-9-17)11-4-5-16-10-12(11)14;;/h4-5,10,13,15H,2-3,6-9H2,1H3;2*1H/t13-;;/m1../s1 |
| InChIKey | ZELQLWLOSBKEAQ-FFXKMJQXSA-N |
| XLogP | 3.33 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |