C14H21IN2 — CID 171280679
1-[(1S)-1-(2-iodophenyl)butyl]piperazine (PubChem CID 171280679) has the molecular formula C14H21IN2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-[(1S)-1-(2-iodophenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-iodophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171280679 |
| Molecular Formula | C14H21IN2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[(1S)-1-(2-iodophenyl)butyl]piperazine |
| SMILES | CCC[C@@H](c1ccccc1I)N1CCNCC1 |
| InChI | InChI=1S/C14H21IN2/c1-2-5-14(17-10-8-16-9-11-17)12-6-3-4-7-13(12)15/h3-4,6-7,14,16H,2,5,8-11H2,1H3/t14-/m0/s1 |
| InChIKey | UKTHGFPDKCEQJA-AWEZNQCLSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|