C12H18Cl3FN2O — CID 171300275
2-chloro-3-fluoro-6-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride (PubChem CID 171300275) has the molecular formula C12H18Cl3FN2O and a molecular weight of 331.65 g/mol. Its IUPAC name is 2-chloro-3-fluoro-6-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride.
| Compound Name | 2-chloro-3-fluoro-6-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171300275 |
| Molecular Formula | C12H18Cl3FN2O |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-chloro-3-fluoro-6-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride |
| SMILES | C[C@H](c1ccc(F)c(Cl)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H16ClFN2O.2ClH/c1-8(16-6-4-15-5-7-16)9-2-3-10(14)11(13)12(9)17;;/h2-3,8,15,17H,4-7H2,1H3;2*1H/t8-;;/m1../s1 |
| InChIKey | OWBXDWJMDVINAN-YCBDHFTFSA-N |
| XLogP | 2.99 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|