C16H22ClFN2O — CID 171297813
2-chloro-6-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-fluorophenol (PubChem CID 171297813) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-chloro-6-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-fluorophenol.
| Compound Name | 2-chloro-6-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-fluorophenol |
|---|---|
| PubChem CID | 171297813 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-chloro-6-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-fluorophenol |
| SMILES | Oc1c([C@H](C2CCCC2)N2CCNCC2)ccc(F)c1Cl |
| InChI | InChI=1S/C16H22ClFN2O/c17-14-13(18)6-5-12(16(14)21)15(11-3-1-2-4-11)20-9-7-19-8-10-20/h5-6,11,15,19,21H,1-4,7-10H2/t15-/m0/s1 |
| InChIKey | FDTVXIPAHUGVEC-HNNXBMFYSA-N |
| XLogP | 3.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|