C12H17Cl3F2N2 — CID 171292637
1-[(1R)-1-(2-chloro-3,6-difluorophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171292637) has the molecular formula C12H17Cl3F2N2 and a molecular weight of 333.64 g/mol. Its IUPAC name is 1-[(1R)-1-(2-chloro-3,6-difluorophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-chloro-3,6-difluorophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292637 |
| Molecular Formula | C12H17Cl3F2N2 |
| Molecular Weight | 333.64 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-[(1R)-1-(2-chloro-3,6-difluorophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | C[C@H](c1c(F)ccc(F)c1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H15ClF2N2.2ClH/c1-8(17-6-4-16-5-7-17)11-9(14)2-3-10(15)12(11)13;;/h2-3,8,16H,4-7H2,1H3;2*1H/t8-;;/m1../s1 |
| InChIKey | NCAIDNZERGNHOG-YCBDHFTFSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|