C19H27Cl2N3 — CID 171297216
2-[(R)-cyclopentyl(piperazin-1-yl)methyl]quinoline;dihydrochloride (PubChem CID 171297216) has the molecular formula C19H27Cl2N3 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[(R)-cyclopentyl(piperazin-1-yl)methyl]quinoline;dihydrochloride.
| Compound Name | 2-[(R)-cyclopentyl(piperazin-1-yl)methyl]quinoline;dihydrochloride |
|---|---|
| PubChem CID | 171297216 |
| Molecular Formula | C19H27Cl2N3 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[(R)-cyclopentyl(piperazin-1-yl)methyl]quinoline;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2nc([C@@H](C3CCCC3)N3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C19H25N3.2ClH/c1-2-7-16(6-1)19(22-13-11-20-12-14-22)18-10-9-15-5-3-4-8-17(15)21-18;;/h3-5,8-10,16,19-20H,1-2,6-7,11-14H2;2*1H/t19-;;/m1../s1 |
| InChIKey | AXXGUOYVAGZBRN-JQDLGSOUSA-N |
| XLogP | 4.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |