C14H24Cl2FN3 — CID 171304461
1-[(1R)-1-(2-fluoro-3-pyridinyl)-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171304461) has the molecular formula C14H24Cl2FN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 1-[(1R)-1-(2-fluoro-3-pyridinyl)-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-fluoro-3-pyridinyl)-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171304461 |
| Molecular Formula | C14H24Cl2FN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[(1R)-1-(2-fluoro-3-pyridinyl)-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@H](c1cccnc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H22FN3.2ClH/c1-3-11(2)13(18-9-7-16-8-10-18)12-5-4-6-17-14(12)15;;/h4-6,11,13,16H,3,7-10H2,1-2H3;2*1H/t11?,13-;;/m1../s1 |
| InChIKey | PEJQUQIFBNKXLA-RNVQNLIPSA-N |
| XLogP | 3.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|