C17H30Cl2N2 — CID 171305273
1-[(1S)-1-(2,6-dimethylphenyl)-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171305273) has the molecular formula C17H30Cl2N2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-[(1S)-1-(2,6-dimethylphenyl)-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2,6-dimethylphenyl)-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305273 |
| Molecular Formula | C17H30Cl2N2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(1S)-1-(2,6-dimethylphenyl)-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1c(C)cccc1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H28N2.2ClH/c1-5-13(2)17(19-11-9-18-10-12-19)16-14(3)7-6-8-15(16)4;;/h6-8,13,17-18H,5,9-12H2,1-4H3;2*1H/t13?,17-;;/m0../s1 |
| InChIKey | CWGMOZNHJLQHJA-GFKZBSTBSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |