C12H15Br3N2O2 — CID 171183281
2,4,6-tribromo-3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenol (PubChem CID 171183281) has the molecular formula C12H15Br3N2O2 and a molecular weight of 458.98 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenol.
| Compound Name | 2,4,6-tribromo-3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171183281 |
| Molecular Formula | C12H15Br3N2O2 |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 455.87 |
| IUPAC Name | 2,4,6-tribromo-3-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]phenol |
| SMILES | OC[C@H](c1c(Br)cc(Br)c(O)c1Br)N1CCNCC1 |
| InChI | InChI=1S/C12H15Br3N2O2/c13-7-5-8(14)12(19)11(15)10(7)9(6-18)17-3-1-16-2-4-17/h5,9,16,18-19H,1-4,6H2/t9-/m1/s1 |
| InChIKey | PDYZMMXXKJLDGH-SECBINFHSA-N |
| XLogP | 2.62 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |