C9H12Br2ClNS — CID 171235193
(1S)-1-(4,5-dibromothiophen-2-yl)pent-4-en-1-amine;hydrochloride (PubChem CID 171235193) has the molecular formula C9H12Br2ClNS and a molecular weight of 361.53 g/mol. Its IUPAC name is (1S)-1-(4,5-dibromothiophen-2-yl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4,5-dibromothiophen-2-yl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171235193 |
| Molecular Formula | C9H12Br2ClNS |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 358.87 |
| IUPAC Name | (1S)-1-(4,5-dibromothiophen-2-yl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@H](N)c1cc(Br)c(Br)s1.Cl |
| InChI | InChI=1S/C9H11Br2NS.ClH/c1-2-3-4-7(12)8-5-6(10)9(11)13-8;/h2,5,7H,1,3-4,12H2;1H/t7-;/m0./s1 |
| InChIKey | AJVAGFAJAWMBRJ-FJXQXJEOSA-N |
| XLogP | 4.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|