C11H14Br2ClN — CID 171215459
(1R)-1-(3,4-dibromophenyl)pent-4-en-1-amine;hydrochloride (PubChem CID 171215459) has the molecular formula C11H14Br2ClN and a molecular weight of 355.50 g/mol. Its IUPAC name is (1R)-1-(3,4-dibromophenyl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3,4-dibromophenyl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171215459 |
| Molecular Formula | C11H14Br2ClN |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 352.92 |
| IUPAC Name | (1R)-1-(3,4-dibromophenyl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1ccc(Br)c(Br)c1.Cl |
| InChI | InChI=1S/C11H13Br2N.ClH/c1-2-3-4-11(14)8-5-6-9(12)10(13)7-8;/h2,5-7,11H,1,3-4,14H2;1H/t11-;/m1./s1 |
| InChIKey | UYBVFTUKRXYYIR-RFVHGSKJSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|