C12H17Br2N — CID 171215462
(1R)-1-(3,4-dibromophenyl)-4-methylpentan-1-amine (PubChem CID 171215462) has the molecular formula C12H17Br2N and a molecular weight of 335.08 g/mol. Its IUPAC name is (1R)-1-(3,4-dibromophenyl)-4-methylpentan-1-amine.
| Compound Name | (1R)-1-(3,4-dibromophenyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 171215462 |
| Molecular Formula | C12H17Br2N |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | (1R)-1-(3,4-dibromophenyl)-4-methylpentan-1-amine |
| SMILES | CC(C)CC[C@@H](N)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C12H17Br2N/c1-8(2)3-6-12(15)9-4-5-10(13)11(14)7-9/h4-5,7-8,12H,3,6,15H2,1-2H3/t12-/m1/s1 |
| InChIKey | ZNLNXBMYTPLJEW-GFCCVEGCSA-N |
| XLogP | 4.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |