C13H20Br2ClNO — CID 171271478
(1S,2R)-1-amino-1-(3,4-dibromophenyl)-5-methylhexan-2-ol;hydrochloride (PubChem CID 171271478) has the molecular formula C13H20Br2ClNO and a molecular weight of 401.57 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3,4-dibromophenyl)-5-methylhexan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(3,4-dibromophenyl)-5-methylhexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171271478 |
| Molecular Formula | C13H20Br2ClNO |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | (1S,2R)-1-amino-1-(3,4-dibromophenyl)-5-methylhexan-2-ol;hydrochloride |
| SMILES | CC(C)CC[C@@H](O)[C@@H](N)c1ccc(Br)c(Br)c1.Cl |
| InChI | InChI=1S/C13H19Br2NO.ClH/c1-8(2)3-6-12(17)13(16)9-4-5-10(14)11(15)7-9;/h4-5,7-8,12-13,17H,3,6,16H2,1-2H3;1H/t12-,13+;/m1./s1 |
| InChIKey | MVLRNAXKYGBUQZ-KZCZEQIWSA-N |
| XLogP | 4.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |