C13H20BrClN2O3 — CID 171268512
(1S,2R)-1-amino-1-(4-bromo-3-nitrophenyl)-5-methylhexan-2-ol;hydrochloride (PubChem CID 171268512) has the molecular formula C13H20BrClN2O3 and a molecular weight of 367.67 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(4-bromo-3-nitrophenyl)-5-methylhexan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(4-bromo-3-nitrophenyl)-5-methylhexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171268512 |
| Molecular Formula | C13H20BrClN2O3 |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (1S,2R)-1-amino-1-(4-bromo-3-nitrophenyl)-5-methylhexan-2-ol;hydrochloride |
| SMILES | CC(C)CC[C@@H](O)[C@@H](N)c1ccc(Br)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C13H19BrN2O3.ClH/c1-8(2)3-6-12(17)13(15)9-4-5-10(14)11(7-9)16(18)19;/h4-5,7-8,12-13,17H,3,6,15H2,1-2H3;1H/t12-,13+;/m1./s1 |
| InChIKey | BPGNAMRORCZPAO-KZCZEQIWSA-N |
| XLogP | 3.58 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|