C12H16BrClN2O3 — CID 171268494
(1R,2S)-2-amino-2-(4-bromo-3-nitrophenyl)-1-cyclobutylethanol;hydrochloride (PubChem CID 171268494) has the molecular formula C12H16BrClN2O3 and a molecular weight of 351.63 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(4-bromo-3-nitrophenyl)-1-cyclobutylethanol;hydrochloride.
| Compound Name | (1R,2S)-2-amino-2-(4-bromo-3-nitrophenyl)-1-cyclobutylethanol;hydrochloride |
|---|---|
| PubChem CID | 171268494 |
| Molecular Formula | C12H16BrClN2O3 |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | (1R,2S)-2-amino-2-(4-bromo-3-nitrophenyl)-1-cyclobutylethanol;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(Br)c([N+](=O)[O-])c1)[C@H](O)C1CCC1 |
| InChI | InChI=1S/C12H15BrN2O3.ClH/c13-9-5-4-8(6-10(9)15(17)18)11(14)12(16)7-2-1-3-7;/h4-7,11-12,16H,1-3,14H2;1H/t11-,12+;/m0./s1 |
| InChIKey | XGZIMTDVTSZHJF-ZVWHLABXSA-N |
| XLogP | 2.94 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|