C10H11Br2NS — CID 105037154
1-(4,5-dibromothiophen-2-yl)hex-4-yn-1-amine (PubChem CID 105037154) has the molecular formula C10H11Br2NS and a molecular weight of 337.08 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)hex-4-yn-1-amine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)hex-4-yn-1-amine |
|---|---|
| PubChem CID | 105037154 |
| Molecular Formula | C10H11Br2NS |
| Molecular Weight | 337.08 g/mol |
| Exact Mass | 334.90 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)hex-4-yn-1-amine |
| SMILES | CC#CCCC(N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H11Br2NS/c1-2-3-4-5-8(13)9-6-7(11)10(12)14-9/h6,8H,4-5,13H2,1H3 |
| InChIKey | FTUNSHRMCOFVNV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.08 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|