C10H12Br2N2S — CID 102839925
N-but-2-ynyl-1-(4,5-dibromothiophen-2-yl)ethane-1,2-diamine (PubChem CID 102839925) has the molecular formula C10H12Br2N2S and a molecular weight of 352.10 g/mol. Its IUPAC name is N-but-2-ynyl-1-(4,5-dibromothiophen-2-yl)ethane-1,2-diamine.
| Compound Name | N-but-2-ynyl-1-(4,5-dibromothiophen-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102839925 |
| Molecular Formula | C10H12Br2N2S |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | N-but-2-ynyl-1-(4,5-dibromothiophen-2-yl)ethane-1,2-diamine |
| SMILES | CC#CCNC(CN)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H12Br2N2S/c1-2-3-4-14-8(6-13)9-5-7(11)10(12)15-9/h5,8,14H,4,6,13H2,1H3 |
| InChIKey | KZSSBBUJMVJPEG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|