C9H14Br2N2S — CID 130870793
1-(4,5-dibromothiophen-2-yl)-3-methylbutane-1,2-diamine (PubChem CID 130870793) has the molecular formula C9H14Br2N2S and a molecular weight of 342.10 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-3-methylbutane-1,2-diamine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 130870793 |
| Molecular Formula | C9H14Br2N2S |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(N)C(N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H14Br2N2S/c1-4(2)7(12)8(13)6-3-5(10)9(11)14-6/h3-4,7-8H,12-13H2,1-2H3 |
| InChIKey | HNQLUTOWJIXWKK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |