C10H10Br2ClNOS — CID 102844193
2-chloro-2-(4,5-dibromothiophen-2-yl)-1-pyrrolidin-1-ylethanone (PubChem CID 102844193) has the molecular formula C10H10Br2ClNOS and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-chloro-2-(4,5-dibromothiophen-2-yl)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-chloro-2-(4,5-dibromothiophen-2-yl)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 102844193 |
| Molecular Formula | C10H10Br2ClNOS |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 384.85 |
| IUPAC Name | 2-chloro-2-(4,5-dibromothiophen-2-yl)-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(C(Cl)c1cc(Br)c(Br)s1)N1CCCC1 |
| InChI | InChI=1S/C10H10Br2ClNOS/c11-6-5-7(16-9(6)12)8(13)10(15)14-3-1-2-4-14/h5,8H,1-4H2 |
| InChIKey | CAWUESKABBCREW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|