C9H11Br2ClS — CID 80534293
2,3-dibromo-5-(1-chloro-2,2-dimethylpropyl)thiophene (PubChem CID 80534293) has the molecular formula C9H11Br2ClS and a molecular weight of 346.52 g/mol. Its IUPAC name is 2,3-dibromo-5-(1-chloro-2,2-dimethylpropyl)thiophene.
| Compound Name | 2,3-dibromo-5-(1-chloro-2,2-dimethylpropyl)thiophene |
|---|---|
| PubChem CID | 80534293 |
| Molecular Formula | C9H11Br2ClS |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 343.86 |
| IUPAC Name | 2,3-dibromo-5-(1-chloro-2,2-dimethylpropyl)thiophene |
| SMILES | CC(C)(C)C(Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H11Br2ClS/c1-9(2,3)7(12)6-4-5(10)8(11)13-6/h4,7H,1-3H3 |
| InChIKey | BJKNMWXUMPHYPM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|