C10H15Br2NS — CID 80533046
1-(4,5-dibromothiophen-2-yl)-2,2-dimethylbutan-1-amine (PubChem CID 80533046) has the molecular formula C10H15Br2NS and a molecular weight of 341.11 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2,2-dimethylbutan-1-amine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 80533046 |
| Molecular Formula | C10H15Br2NS |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(C)C(N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H15Br2NS/c1-4-10(2,3)8(13)7-5-6(11)9(12)14-7/h5,8H,4,13H2,1-3H3 |
| InChIKey | YEPLRCXRUVKJAR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |