About methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate
methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate (PubChem CID 171244816) has the molecular formula C10H13Br2NO2S
and a molecular weight of 371.09 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate |
| PubChem CID | 171244816 |
| Molecular Formula | C10H13Br2NO2S |
| Molecular Weight | 371.09 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H13Br2NO2S/c1-10(2,9(14)15-3)7(13)6-4-5(11)8(12)16-6/h4,7H,13H2,1-3H3/t7-/m1/s1 |
| InChIKey | YDZNFJHECVICGZ-SSDOTTSWSA-N |
| XLogP | 3.47 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.09 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate?
The IUPAC name of methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate (CID 171244816) is methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate.
What is the SMILES notation for methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate?
The canonical SMILES for methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate is COC(=O)C(C)(C)[C@H](N)c1cc(Br)c(Br)s1.
What is the InChIKey of methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate?
The InChIKey is YDZNFJHECVICGZ-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H13Br2NO2S/c1-10(2,9(14)15-3)7(13)6-4-5(11)8(12)16-6/h4,7H,13H2,1-3H3/t7-/m1/s1.
What are the key properties of methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate?
methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate has a molecular weight of 371.09 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-amino-3-(4,5-dibromothiophen-2-yl)-2,2-dimethylpropanoate is sourced from PubChem (CID 171244816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).