C9H9Br2NO3S — CID 102841092
2-(4,5-dibromothiophen-2-yl)-2-[ethyl(formyl)amino]acetic acid (PubChem CID 102841092) has the molecular formula C9H9Br2NO3S and a molecular weight of 371.05 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-2-[ethyl(formyl)amino]acetic acid.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-2-[ethyl(formyl)amino]acetic acid |
|---|---|
| PubChem CID | 102841092 |
| Molecular Formula | C9H9Br2NO3S |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 368.87 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-2-[ethyl(formyl)amino]acetic acid |
| SMILES | CCN(C=O)C(C(=O)O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H9Br2NO3S/c1-2-12(4-13)7(9(14)15)6-3-5(10)8(11)16-6/h3-4,7H,2H2,1H3,(H,14,15) |
| InChIKey | ANPPDKQKVZTYPM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|