2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid

C13H17NO5 — CID 63689435

IUPAC2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid
SMILESCCN(C=O)C(C(=O)O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C13H17NO5/c1-4-14(8-15)12(13(16)17)9-5-10(18-2)7-11(6-9)19-3/h5-8,12H,4H2,1-3H3,(H,16,17)
InChIKeyMDLWDVVOZLCDQK-UHFFFAOYSA-N
MW267.28 g/mol
LogP1.31
Rot. Bonds7

About 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid

2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid (PubChem CID 63689435) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid.

Molecular Properties

Compound Name2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid
PubChem CID63689435
Molecular FormulaC13H17NO5
Molecular Weight267.28 g/mol
Exact Mass267.11
IUPAC Name2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid
SMILESCCN(C=O)C(C(=O)O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C13H17NO5/c1-4-14(8-15)12(13(16)17)9-5-10(18-2)7-11(6-9)19-3/h5-8,12H,4H2,1-3H3,(H,16,17)
InChIKeyMDLWDVVOZLCDQK-UHFFFAOYSA-N
XLogP1.31
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.28
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid?
The IUPAC name of 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid (CID 63689435) is 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid.
What is the SMILES notation for 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid?
The canonical SMILES for 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid is CCN(C=O)C(C(=O)O)c1cc(OC)cc(OC)c1.
What is the InChIKey of 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid?
The InChIKey is MDLWDVVOZLCDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-4-14(8-15)12(13(16)17)9-5-10(18-2)7-11(6-9)19-3/h5-8,12H,4H2,1-3H3,(H,16,17).
What are the key properties of 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid?
2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid has a molecular weight of 267.28 g/mol, XLogP of 1.31, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethoxyphenyl)-2-[ethyl(formyl)amino]acetic acid is sourced from PubChem (CID 63689435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).